C22H23N3O3 — CID 52950486
6-[(E)-3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 52950486) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 6-[(E)-3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 52950486 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 6-[(E)-3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CCC(O)(c4ccccc4)CC3)cnc2N1 |
| InChI | InChI=1S/C22H23N3O3/c26-19-8-7-17-14-16(15-23-21(17)24-19)6-9-20(27)25-12-10-22(28,11-13-25)18-4-2-1-3-5-18/h1-6,9,14-15,28H,7-8,10-13H2,(H,23,24,26)/b9-6+ |
| InChIKey | FPEKLOOAKYGFFC-RMKNXTFCSA-N |
| XLogP | 2.49 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|