About 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide
4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (PubChem CID 5295050) has the molecular formula C17H15F3N4O4S
and a molecular weight of 428.39 g/mol. Its IUPAC name is 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| PubChem CID | 5295050 |
| Molecular Formula | C17H15F3N4O4S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC2(C(F)(F)F)NC(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C17H15F3N4O4S/c18-17(19,20)16(23-29(27,28)13-8-6-12(21)7-9-13)14(25)24(15(26)22-16)10-11-4-2-1-3-5-11/h1-9,23H,10,21H2,(H,22,26) |
| InChIKey | GZBWIJWWJQMZDW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
The IUPAC name of 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide (CID 5295050) is 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide.
What is the SMILES notation for 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
The canonical SMILES for 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide is Nc1ccc(S(=O)(=O)NC2(C(F)(F)F)NC(=O)N(Cc3ccccc3)C2=O)cc1.
What is the InChIKey of 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
The InChIKey is GZBWIJWWJQMZDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O4S/c18-17(19,20)16(23-29(27,28)13-8-6-12(21)7-9-13)14(25)24(15(26)22-16)10-11-4-2-1-3-5-11/h1-9,23H,10,21H2,(H,22,26).
What are the key properties of 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide?
4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide has a molecular weight of 428.39 g/mol, XLogP of 1.56, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzenesulfonamide is sourced from PubChem (CID 5295050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).