C21H22N6O3 — CID 52950527
6-[(E)-3-oxo-3-[3-[(E)-1-pyrimidin-2-ylpropan-2-ylideneamino]oxyazetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 52950527) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-[3-[(E)-1-pyrimidin-2-ylpropan-2-ylideneamino]oxyazetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-[3-[(E)-1-pyrimidin-2-ylpropan-2-ylideneamino]oxyazetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 52950527 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 6-[(E)-3-oxo-3-[3-[(E)-1-pyrimidin-2-ylpropan-2-ylideneamino]oxyazetidin-1-yl]prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | C/C(Cc1ncccn1)=N\OC1CN(C(=O)/C=C/c2cnc3c(c2)CCC(=O)N3)C1 |
| InChI | InChI=1S/C21H22N6O3/c1-14(9-18-22-7-2-8-23-18)26-30-17-12-27(13-17)20(29)6-3-15-10-16-4-5-19(28)25-21(16)24-11-15/h2-3,6-8,10-11,17H,4-5,9,12-13H2,1H3,(H,24,25,28)/b6-3+,26-14+ |
| InChIKey | GQMLYNXCQKUYTD-MFZKSGLQSA-N |
| XLogP | 1.62 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|