C28H43NO5S — CID 52950823
(4S,7R,8S,9S,10R,13Z,16S)-4,8-dihydroxy-5,5,7,9,10,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 52950823) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is (4S,7R,8S,9S,10R,13Z,16S)-4,8-dihydroxy-5,5,7,9,10,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10R,13Z,16S)-4,8-dihydroxy-5,5,7,9,10,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 52950823 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (4S,7R,8S,9S,10R,13Z,16S)-4,8-dihydroxy-5,5,7,9,10,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)CC1 |
| InChI | InChI=1S/C28H43NO5S/c1-16-9-11-17(2)19(4)26(32)20(5)27(33)28(7,8)24(30)14-25(31)34-23(12-10-16)18(3)13-22-15-35-21(6)29-22/h10,13,15,17,19-20,23-24,26,30,32H,9,11-12,14H2,1-8H3/b16-10-,18-13+/t17-,19+,20-,23+,24+,26+/m1/s1 |
| InChIKey | OREZSJCFUWZSNV-IFSXWDJTSA-N |
| XLogP | 5.51 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|