About (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide
(E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide (PubChem CID 52951172) has the molecular formula C16H18N2O4
and a molecular weight of 302.33 g/mol. Its IUPAC name is (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide |
| PubChem CID | 52951172 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide |
| SMILES | CN1CCC2(CC1)Oc1ccc(/C=C/C(=O)NO)cc1C2=O |
| InChI | InChI=1S/C16H18N2O4/c1-18-8-6-16(7-9-18)15(20)12-10-11(2-4-13(12)22-16)3-5-14(19)17-21/h2-5,10,21H,6-9H2,1H3,(H,17,19)/b5-3+ |
| InChIKey | LJKAHHRXQFBAHC-HWKANZROSA-N |
| XLogP | 1.24 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide?
The IUPAC name of (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide (CID 52951172) is (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide?
The canonical SMILES for (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide is CN1CCC2(CC1)Oc1ccc(/C=C/C(=O)NO)cc1C2=O.
What is the InChIKey of (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide?
The InChIKey is LJKAHHRXQFBAHC-HWKANZROSA-N. The full InChI is InChI=1S/C16H18N2O4/c1-18-8-6-16(7-9-18)15(20)12-10-11(2-4-13(12)22-16)3-5-14(19)17-21/h2-5,10,21H,6-9H2,1H3,(H,17,19)/b5-3+.
What are the key properties of (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide?
(E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide has a molecular weight of 302.33 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-hydroxy-3-(1'-methyl-3-oxospiro[1-benzofuran-2,4'-piperidine]-5-yl)prop-2-enamide is sourced from PubChem (CID 52951172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).