About 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one
1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one (PubChem CID 52951284) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one.
Molecular Properties
| Compound Name | 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one |
| PubChem CID | 52951284 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1CCC=C(CCCC)O1 |
| InChI | InChI=1S/C14H24O2/c1-3-5-8-12-9-7-11-14(16-12)13(15)10-6-4-2/h9,14H,3-8,10-11H2,1-2H3 |
| InChIKey | RQEHHCWOZQMSNU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one?
The IUPAC name of 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one (CID 52951284) is 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one.
What is the SMILES notation for 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one?
The canonical SMILES for 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one is CCCCC(=O)C1CCC=C(CCCC)O1.
What is the InChIKey of 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one?
The InChIKey is RQEHHCWOZQMSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-3-5-8-12-9-7-11-14(16-12)13(15)10-6-4-2/h9,14H,3-8,10-11H2,1-2H3.
What are the key properties of 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one?
1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one has a molecular weight of 224.34 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one is sourced from PubChem (CID 52951284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).