C14H24O2 — CID 52951284
1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one (PubChem CID 52951284) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one.
| Compound Name | 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 52951284 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(6-butyl-3,4-dihydro-2H-pyran-2-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1CCC=C(CCCC)O1 |
| InChI | InChI=1S/C14H24O2/c1-3-5-8-12-9-7-11-14(16-12)13(15)10-6-4-2/h9,14H,3-8,10-11H2,1-2H3 |
| InChIKey | RQEHHCWOZQMSNU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |