About (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione
(1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 52951289) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
Molecular Properties
| Compound Name | (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| PubChem CID | 52951289 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | COC1=CC(=O)[C@H]2O[C@H]2C1=O |
| InChI | InChI=1S/C7H6O4/c1-10-4-2-3(8)6-7(11-6)5(4)9/h2,6-7H,1H3/t6-,7+/m1/s1 |
| InChIKey | APHNCOMGZZKBKY-RQJHMYQMSA-N |
| XLogP | -0.56 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The IUPAC name of (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (CID 52951289) is (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
What is the SMILES notation for (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The canonical SMILES for (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione is COC1=CC(=O)[C@H]2O[C@H]2C1=O.
What is the InChIKey of (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The InChIKey is APHNCOMGZZKBKY-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H6O4/c1-10-4-2-3(8)6-7(11-6)5(4)9/h2,6-7H,1H3/t6-,7+/m1/s1.
What are the key properties of (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
(1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione has a molecular weight of 154.12 g/mol, XLogP of -0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-3-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione is sourced from PubChem (CID 52951289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).