C17H24O2 — CID 52951412
[(1E,3E)-2-methyl-5-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]penta-1,3-dienyl] acetate (PubChem CID 52951412) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is [(1E,3E)-2-methyl-5-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]penta-1,3-dienyl] acetate.
| Compound Name | [(1E,3E)-2-methyl-5-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]penta-1,3-dienyl] acetate |
|---|---|
| PubChem CID | 52951412 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(1E,3E)-2-methyl-5-[(1S,2R,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]penta-1,3-dienyl] acetate |
| SMILES | C=C1[C@@H]2CC[C@@H](C2)[C@@]1(C)C/C=C/C(C)=C/OC(C)=O |
| InChI | InChI=1S/C17H24O2/c1-12(11-19-14(3)18)6-5-9-17(4)13(2)15-7-8-16(17)10-15/h5-6,11,15-16H,2,7-10H2,1,3-4H3/b6-5+,12-11+/t15-,16+,17+/m1/s1 |
| InChIKey | HVLZXEJJDUKEHH-JJAUSRCGSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|