C24H24ClN3O6S2 — CID 52951584
tert-butyl (1S,2R,3R)-1-[[5-(5-chloro-2-pyridinyl)-4-nitrothiophen-2-yl]sulfonylamino]-2-methyl-3-phenylcyclopropane-1-carboxylate (PubChem CID 52951584) has the molecular formula C24H24ClN3O6S2 and a molecular weight of 550.06 g/mol. Its IUPAC name is tert-butyl (1S,2R,3R)-1-[[5-(5-chloro-2-pyridinyl)-4-nitrothiophen-2-yl]sulfonylamino]-2-methyl-3-phenylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl (1S,2R,3R)-1-[[5-(5-chloro-2-pyridinyl)-4-nitrothiophen-2-yl]sulfonylamino]-2-methyl-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 52951584 |
| Molecular Formula | C24H24ClN3O6S2 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | tert-butyl (1S,2R,3R)-1-[[5-(5-chloro-2-pyridinyl)-4-nitrothiophen-2-yl]sulfonylamino]-2-methyl-3-phenylcyclopropane-1-carboxylate |
| SMILES | C[C@@H]1[C@H](c2ccccc2)[C@]1(NS(=O)(=O)c1cc([N+](=O)[O-])c(-c2ccc(Cl)cn2)s1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H24ClN3O6S2/c1-14-20(15-8-6-5-7-9-15)24(14,22(29)34-23(2,3)4)27-36(32,33)19-12-18(28(30)31)21(35-19)17-11-10-16(25)13-26-17/h5-14,20,27H,1-4H3/t14-,20-,24+/m1/s1 |
| InChIKey | GOZHNNPTPVLTFQ-UCWRBECXSA-N |
| XLogP | 5.16 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|