C17H11ClF3N3O2S — CID 52951660
[4-(trifluoromethyl)phenyl] (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]carbamate (PubChem CID 52951660) has the molecular formula C17H11ClF3N3O2S and a molecular weight of 413.81 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]carbamate.
| Compound Name | [4-(trifluoromethyl)phenyl] (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]carbamate |
|---|---|
| PubChem CID | 52951660 |
| Molecular Formula | C17H11ClF3N3O2S |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] (NZ)-N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazol-2-ylidene]carbamate |
| SMILES | O=C(/N=c1\sccn1Cc1ccc(Cl)nc1)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11ClF3N3O2S/c18-14-6-1-11(9-22-14)10-24-7-8-27-15(24)23-16(25)26-13-4-2-12(3-5-13)17(19,20)21/h1-9H,10H2/b23-15- |
| InChIKey | CECKIFLAMIEWFZ-HAHDFKILSA-N |
| XLogP | 4.76 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|