C31H53NO2SiSn — CID 52951699
tert-butyl-[2,3-dihydro-1H-inden-2-yl-(5-tributylstannyl-1,3-oxazol-2-yl)methoxy]-dimethylsilane (PubChem CID 52951699) has the molecular formula C31H53NO2SiSn and a molecular weight of 618.57 g/mol. Its IUPAC name is tert-butyl-[2,3-dihydro-1H-inden-2-yl-(5-tributylstannyl-1,3-oxazol-2-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2,3-dihydro-1H-inden-2-yl-(5-tributylstannyl-1,3-oxazol-2-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 52951699 |
| Molecular Formula | C31H53NO2SiSn |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | tert-butyl-[2,3-dihydro-1H-inden-2-yl-(5-tributylstannyl-1,3-oxazol-2-yl)methoxy]-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(C(O[Si](C)(C)C(C)(C)C)C2Cc3ccccc3C2)o1 |
| InChI | InChI=1S/C19H26NO2Si.3C4H9.Sn/c1-19(2,3)23(4,5)22-17(18-20-10-11-21-18)16-12-14-8-6-7-9-15(14)13-16;3*1-3-4-2;/h6-10,16-17H,12-13H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | SREMUIHBKOUCLN-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|