About (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol
(1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol (PubChem CID 52951721) has the molecular formula C27H31NO3
and a molecular weight of 417.55 g/mol. Its IUPAC name is (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol |
| PubChem CID | 52951721 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol |
| SMILES | COc1cccc([C@@H](O)CN[C@H]2CC[C@@H](C(c3ccccc3)c3ccccc3)OC2)c1 |
| InChI | InChI=1S/C27H31NO3/c1-30-24-14-8-13-22(17-24)25(29)18-28-23-15-16-26(31-19-23)27(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-14,17,23,25-29H,15-16,18-19H2,1H3/t23-,25-,26-/m0/s1 |
| InChIKey | CYXMIZFRSKEIMP-RNXOBYDBSA-N |
| XLogP | 4.70 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol?
The IUPAC name of (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol (CID 52951721) is (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol.
What is the SMILES notation for (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol?
The canonical SMILES for (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol is COc1cccc([C@@H](O)CN[C@H]2CC[C@@H](C(c3ccccc3)c3ccccc3)OC2)c1.
What is the InChIKey of (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol?
The InChIKey is CYXMIZFRSKEIMP-RNXOBYDBSA-N. The full InChI is InChI=1S/C27H31NO3/c1-30-24-14-8-13-22(17-24)25(29)18-28-23-15-16-26(31-19-23)27(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-14,17,23,25-29H,15-16,18-19H2,1H3/t23-,25-,26-/m0/s1.
What are the key properties of (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol?
(1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol has a molecular weight of 417.55 g/mol, XLogP of 4.70, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[[(3S,6S)-6-benzhydryloxan-3-yl]amino]-1-(3-methoxyphenyl)ethanol is sourced from PubChem (CID 52951721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).