C30H42O11 — CID 52951754
[(1S,2S,3S,4S,5R,8S,9S,11R,12Z,14S,17R)-2,5-diacetyloxy-4,9-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] hexanoate (PubChem CID 52951754) has the molecular formula C30H42O11 and a molecular weight of 578.66 g/mol. Its IUPAC name is [(1S,2S,3S,4S,5R,8S,9S,11R,12Z,14S,17R)-2,5-diacetyloxy-4,9-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] hexanoate.
| Compound Name | [(1S,2S,3S,4S,5R,8S,9S,11R,12Z,14S,17R)-2,5-diacetyloxy-4,9-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] hexanoate |
|---|---|
| PubChem CID | 52951754 |
| Molecular Formula | C30H42O11 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [(1S,2S,3S,4S,5R,8S,9S,11R,12Z,14S,17R)-2,5-diacetyloxy-4,9-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-11-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1C[C@H](O)[C@@]2(C)C=C[C@@H](OC(C)=O)[C@@](C)(O)[C@@H]2[C@H](OC(C)=O)[C@]23O[C@@]2(C)C(=O)O[C@H]3/C=C\1C |
| InChI | InChI=1S/C30H42O11/c1-8-9-10-11-23(34)39-19-15-20(33)27(5)13-12-21(37-17(3)31)28(6,36)24(27)25(38-18(4)32)30-22(14-16(19)2)40-26(35)29(30,7)41-30/h12-14,19-22,24-25,33,36H,8-11,15H2,1-7H3/b16-14-/t19-,20+,21-,22+,24-,25+,27-,28-,29+,30+/m1/s1 |
| InChIKey | FRHNNILIALBLSU-XIVSLCBISA-N |
| XLogP | 2.45 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|