About 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol
2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol (PubChem CID 52951853) has the molecular formula C25H27NO2
and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol |
| PubChem CID | 52951853 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol |
| SMILES | Oc1ccccc1CN[C@H]1CC[C@@H](C(c2ccccc2)c2ccccc2)OC1 |
| InChI | InChI=1S/C25H27NO2/c27-23-14-8-7-13-21(23)17-26-22-15-16-24(28-18-22)25(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,22,24-27H,15-18H2/t22-,24-/m0/s1 |
| InChIKey | JCWIMJQNQNXQKG-UPVQGACJSA-N |
| XLogP | 4.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol?
The IUPAC name of 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol (CID 52951853) is 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol.
What is the SMILES notation for 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol?
The canonical SMILES for 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol is Oc1ccccc1CN[C@H]1CC[C@@H](C(c2ccccc2)c2ccccc2)OC1.
What is the InChIKey of 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol?
The InChIKey is JCWIMJQNQNXQKG-UPVQGACJSA-N. The full InChI is InChI=1S/C25H27NO2/c27-23-14-8-7-13-21(23)17-26-22-15-16-24(28-18-22)25(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,22,24-27H,15-18H2/t22-,24-/m0/s1.
What are the key properties of 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol?
2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol has a molecular weight of 373.50 g/mol, XLogP of 4.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(3S,6S)-6-benzhydryloxan-3-yl]amino]methyl]phenol is sourced from PubChem (CID 52951853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).