About 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline
4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline (PubChem CID 52952003) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline |
| PubChem CID | 52952003 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline |
| SMILES | CC(C)Cc1nc2ccccc2c2cc[nH]c12 |
| InChI | InChI=1S/C15H16N2/c1-10(2)9-14-15-12(7-8-16-15)11-5-3-4-6-13(11)17-14/h3-8,10,16H,9H2,1-2H3 |
| InChIKey | LEWFRNLLNXKYJJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline?
The IUPAC name of 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline (CID 52952003) is 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline.
What is the SMILES notation for 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline?
The canonical SMILES for 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline is CC(C)Cc1nc2ccccc2c2cc[nH]c12.
What is the InChIKey of 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline?
The InChIKey is LEWFRNLLNXKYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-10(2)9-14-15-12(7-8-16-15)11-5-3-4-6-13(11)17-14/h3-8,10,16H,9H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline?
4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline has a molecular weight of 224.31 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-3H-pyrrolo[2,3-c]quinoline is sourced from PubChem (CID 52952003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).