About 4-benzyl-3H-pyrrolo[2,3-c]quinoline
4-benzyl-3H-pyrrolo[2,3-c]quinoline (PubChem CID 52952004) has the molecular formula C18H14N2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-benzyl-3H-pyrrolo[2,3-c]quinoline.
Molecular Properties
| Compound Name | 4-benzyl-3H-pyrrolo[2,3-c]quinoline |
| PubChem CID | 52952004 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-benzyl-3H-pyrrolo[2,3-c]quinoline |
| SMILES | c1ccc(Cc2nc3ccccc3c3cc[nH]c23)cc1 |
| InChI | InChI=1S/C18H14N2/c1-2-6-13(7-3-1)12-17-18-15(10-11-19-18)14-8-4-5-9-16(14)20-17/h1-11,19H,12H2 |
| InChIKey | PWTJJPSHOLKBPE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-3H-pyrrolo[2,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3H-pyrrolo[2,3-c]quinoline?
The IUPAC name of 4-benzyl-3H-pyrrolo[2,3-c]quinoline (CID 52952004) is 4-benzyl-3H-pyrrolo[2,3-c]quinoline.
What is the SMILES notation for 4-benzyl-3H-pyrrolo[2,3-c]quinoline?
The canonical SMILES for 4-benzyl-3H-pyrrolo[2,3-c]quinoline is c1ccc(Cc2nc3ccccc3c3cc[nH]c23)cc1.
What is the InChIKey of 4-benzyl-3H-pyrrolo[2,3-c]quinoline?
The InChIKey is PWTJJPSHOLKBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2/c1-2-6-13(7-3-1)12-17-18-15(10-11-19-18)14-8-4-5-9-16(14)20-17/h1-11,19H,12H2.
What are the key properties of 4-benzyl-3H-pyrrolo[2,3-c]quinoline?
4-benzyl-3H-pyrrolo[2,3-c]quinoline has a molecular weight of 258.32 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3H-pyrrolo[2,3-c]quinoline is sourced from PubChem (CID 52952004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).