C24H26N4OS — CID 5295206
1-(4-tert-butylphenyl)-4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butan-1-one (PubChem CID 5295206) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butan-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 5295206 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butan-1-one |
| SMILES | Cn1c2ccccc2c2nnc(SCCCC(=O)c3ccc(C(C)(C)C)cc3)nc21 |
| InChI | InChI=1S/C24H26N4OS/c1-24(2,3)17-13-11-16(12-14-17)20(29)10-7-15-30-23-25-22-21(26-27-23)18-8-5-6-9-19(18)28(22)4/h5-6,8-9,11-14H,7,10,15H2,1-4H3 |
| InChIKey | NLFMOXCVBCUNJO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|