C29H31N3O5 — CID 52952071
(3S)-7-[2-(hydroxyamino)-2-oxoethoxy]-N-(2-phenylethyl)-2-(3-phenylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 52952071) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is (3S)-7-[2-(hydroxyamino)-2-oxoethoxy]-N-(2-phenylethyl)-2-(3-phenylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-7-[2-(hydroxyamino)-2-oxoethoxy]-N-(2-phenylethyl)-2-(3-phenylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 52952071 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (3S)-7-[2-(hydroxyamino)-2-oxoethoxy]-N-(2-phenylethyl)-2-(3-phenylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | O=C(COc1ccc2c(c1)CN(C(=O)CCc1ccccc1)[C@H](C(=O)NCCc1ccccc1)C2)NO |
| InChI | InChI=1S/C29H31N3O5/c33-27(31-36)20-37-25-13-12-23-18-26(29(35)30-16-15-22-9-5-2-6-10-22)32(19-24(23)17-25)28(34)14-11-21-7-3-1-4-8-21/h1-10,12-13,17,26,36H,11,14-16,18-20H2,(H,30,35)(H,31,33)/t26-/m0/s1 |
| InChIKey | MTSUXDMDZHIFBC-SANMLTNESA-N |
| XLogP | 2.82 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|