C29H34O11 — CID 52952110
dimethyl 4-[(2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-2-yl]benzene-1,2-dicarboxylate (PubChem CID 52952110) has the molecular formula C29H34O11 and a molecular weight of 558.58 g/mol. Its IUPAC name is dimethyl 4-[(2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-2-yl]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[(2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-2-yl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 52952110 |
| Molecular Formula | C29H34O11 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | dimethyl 4-[(2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-7-methoxycarbonyl-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-2-yl]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc([C@@H]2C[C@]3(C)[C@H]4C(=O)[C@@H](OC(C)=O)C[C@@H](C(=O)OC)[C@]4(C)CC[C@H]3C(=O)O2)cc1C(=O)OC |
| InChI | InChI=1S/C29H34O11/c1-14(30)39-20-12-19(26(34)38-6)28(2)10-9-18-27(35)40-21(13-29(18,3)23(28)22(20)31)15-7-8-16(24(32)36-4)17(11-15)25(33)37-5/h7-8,11,18-21,23H,9-10,12-13H2,1-6H3/t18-,19-,20-,21-,23-,28-,29-/m0/s1 |
| InChIKey | JGLDRKQGSIVCSD-RYLIGVMFSA-N |
| XLogP | 2.98 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|