C10H15N2O9P — CID 52952495
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-methoxy-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 52952495) has the molecular formula C10H15N2O9P and a molecular weight of 338.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-methoxy-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-methoxy-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 52952495 |
| Molecular Formula | C10H15N2O9P |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-methoxy-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COc1nc(=O)ccn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N2O9P/c1-19-10-11-6(13)2-3-12(10)9-8(15)7(14)5(21-9)4-20-22(16,17)18/h2-3,5,7-9,14-15H,4H2,1H3,(H2,16,17,18)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | YZHHOKQNKLNAMB-ZOQUXTDFSA-N |
| XLogP | -2.02 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|