About 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde
1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde (PubChem CID 52952572) has the molecular formula C16H11Br2NO
and a molecular weight of 393.08 g/mol. Its IUPAC name is 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde |
| PubChem CID | 52952572 |
| Molecular Formula | C16H11Br2NO |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde |
| SMILES | O=Cc1cn(Cc2ccc(Br)c(Br)c2)c2ccccc12 |
| InChI | InChI=1S/C16H11Br2NO/c17-14-6-5-11(7-15(14)18)8-19-9-12(10-20)13-3-1-2-4-16(13)19/h1-7,9-10H,8H2 |
| InChIKey | IWVSWZWWTXLVLF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde?
The IUPAC name of 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde (CID 52952572) is 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde.
What is the SMILES notation for 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde?
The canonical SMILES for 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde is O=Cc1cn(Cc2ccc(Br)c(Br)c2)c2ccccc12.
What is the InChIKey of 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde?
The InChIKey is IWVSWZWWTXLVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Br2NO/c17-14-6-5-11(7-15(14)18)8-19-9-12(10-20)13-3-1-2-4-16(13)19/h1-7,9-10H,8H2.
What are the key properties of 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde?
1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde has a molecular weight of 393.08 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dibromophenyl)methyl]indole-3-carbaldehyde is sourced from PubChem (CID 52952572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).