About 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile
4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 52952632) has the molecular formula C19H15F2N5
and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile |
| PubChem CID | 52952632 |
| Molecular Formula | C19H15F2N5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | CC(c1cc(N)nc(Nc2ccc(C#N)cc2)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H15F2N5/c1-11(18-14(20)3-2-4-15(18)21)16-9-17(23)26-19(25-16)24-13-7-5-12(10-22)6-8-13/h2-9,11H,1H3,(H3,23,24,25,26) |
| InChIKey | JONXEBNFQASIFO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile (CID 52952632) is 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile is CC(c1cc(N)nc(Nc2ccc(C#N)cc2)n1)c1c(F)cccc1F.
What is the InChIKey of 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile?
The InChIKey is JONXEBNFQASIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2N5/c1-11(18-14(20)3-2-4-15(18)21)16-9-17(23)26-19(25-16)24-13-7-5-12(10-22)6-8-13/h2-9,11H,1H3,(H3,23,24,25,26).
What are the key properties of 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile?
4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile has a molecular weight of 351.36 g/mol, XLogP of 4.10, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-amino-6-[1-(2,6-difluorophenyl)ethyl]pyrimidin-2-yl]amino]benzonitrile is sourced from PubChem (CID 52952632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).