About 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione
6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione (PubChem CID 52952990) has the molecular formula C20H10Cl3NO2
and a molecular weight of 402.66 g/mol. Its IUPAC name is 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione.
Molecular Properties
| Compound Name | 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione |
| PubChem CID | 52952990 |
| Molecular Formula | C20H10Cl3NO2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione |
| SMILES | O=c1c2ccccc2c2ccccc2c(=O)n1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H10Cl3NO2/c21-16-9-11(10-17(22)18(16)23)24-19(25)14-7-3-1-5-12(14)13-6-2-4-8-15(13)20(24)26/h1-10H |
| InChIKey | VVBLTHNPQQVKDZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione?
The IUPAC name of 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione (CID 52952990) is 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione.
What is the SMILES notation for 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione?
The canonical SMILES for 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione is O=c1c2ccccc2c2ccccc2c(=O)n1-c1cc(Cl)c(Cl)c(Cl)c1.
What is the InChIKey of 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione?
The InChIKey is VVBLTHNPQQVKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl3NO2/c21-16-9-11(10-17(22)18(16)23)24-19(25)14-7-3-1-5-12(14)13-6-2-4-8-15(13)20(24)26/h1-10H.
What are the key properties of 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione?
6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione has a molecular weight of 402.66 g/mol, XLogP of 5.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4,5-trichlorophenyl)benzo[d][2]benzazepine-5,7-dione is sourced from PubChem (CID 52952990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).