C31H41FN10O3S — CID 52953246
2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine (PubChem CID 52953246) has the molecular formula C31H41FN10O3S and a molecular weight of 652.80 g/mol. Its IUPAC name is 2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 52953246 |
| Molecular Formula | C31H41FN10O3S |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | 2-[3-[3-aminopropyl-[[4-[6-[2-fluoro-4-(piperidin-4-ylsulfamoyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine |
| SMILES | NCCCN(CCCN=C(N)N)Cc1ccc(-n2cc3cc(-c4ccc(S(=O)(=O)NC5CCNCC5)cc4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C31H41FN10O3S/c32-27-18-25(46(44,45)40-23-9-13-36-14-10-23)7-8-26(27)28-17-22-20-42(31(43)39-29(22)38-28)24-5-3-21(4-6-24)19-41(15-1-11-33)16-2-12-37-30(34)35/h3-8,17-18,20,23,36,40H,1-2,9-16,19,33H2,(H4,34,35,37)(H,38,39,43) |
| InChIKey | SQZQJQDTONQHIR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 202.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|