C12H14O3 — CID 52953388
(2R)-7-hydroxy-2,6,8-trimethyl-2,3-dihydrochromen-4-one (PubChem CID 52953388) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2R)-7-hydroxy-2,6,8-trimethyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-7-hydroxy-2,6,8-trimethyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 52953388 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2R)-7-hydroxy-2,6,8-trimethyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1cc2c(c(C)c1O)O[C@H](C)CC2=O |
| InChI | InChI=1S/C12H14O3/c1-6-4-9-10(13)5-7(2)15-12(9)8(3)11(6)14/h4,7,14H,5H2,1-3H3/t7-/m1/s1 |
| InChIKey | NRMKSSJMSPJBPA-SSDOTTSWSA-N |
| XLogP | 2.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |