C29H23N5O4 — CID 5295592
2-methyl-4-[5-(4-methyl-3-nitrophenyl)furan-2-yl]-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide (PubChem CID 5295592) has the molecular formula C29H23N5O4 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-methyl-4-[5-(4-methyl-3-nitrophenyl)furan-2-yl]-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | 2-methyl-4-[5-(4-methyl-3-nitrophenyl)furan-2-yl]-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 5295592 |
| Molecular Formula | C29H23N5O4 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-methyl-4-[5-(4-methyl-3-nitrophenyl)furan-2-yl]-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccc(-c3ccc(C)c([N+](=O)[O-])c3)o2)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C29H23N5O4/c1-17-12-13-19(16-23(17)34(36)37)24-14-15-25(38-24)27-26(28(35)31-20-8-4-3-5-9-20)18(2)30-29-32-21-10-6-7-11-22(21)33(27)29/h3-16,27H,1-2H3,(H,30,32)(H,31,35) |
| InChIKey | XBZFCUZMAJJKJC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|