C14H13IN4OS — CID 5295797
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-iodopyrazol-1-yl)acetamide (PubChem CID 5295797) has the molecular formula C14H13IN4OS and a molecular weight of 412.26 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-iodopyrazol-1-yl)acetamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-iodopyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 5295797 |
| Molecular Formula | C14H13IN4OS |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(4-iodopyrazol-1-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)Cn2cc(I)cn2)sc2c1CCCC2 |
| InChI | InChI=1S/C14H13IN4OS/c15-9-6-17-19(7-9)8-13(20)18-14-11(5-16)10-3-1-2-4-12(10)21-14/h6-7H,1-4,8H2,(H,18,20) |
| InChIKey | OXEONHPOKVOFPD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|