About 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one
5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 5295811) has the molecular formula C13H14N2O6
and a molecular weight of 294.26 g/mol. Its IUPAC name is 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| PubChem CID | 5295811 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | Cc1cccc2c1NC(=O)C21OCC(CO)([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C13H14N2O6/c1-8-3-2-4-9-10(8)14-11(17)13(9)20-6-12(5-16,7-21-13)15(18)19/h2-4,16H,5-7H2,1H3,(H,14,17) |
| InChIKey | UZQOJIYHYMJLLX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The IUPAC name of 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one (CID 5295811) is 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The canonical SMILES for 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one is Cc1cccc2c1NC(=O)C21OCC(CO)([N+](=O)[O-])CO1.
What is the InChIKey of 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The InChIKey is UZQOJIYHYMJLLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O6/c1-8-3-2-4-9-10(8)14-11(17)13(9)20-6-12(5-16,7-21-13)15(18)19/h2-4,16H,5-7H2,1H3,(H,14,17).
What are the key properties of 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one has a molecular weight of 294.26 g/mol, XLogP of 0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-7'-methyl-5-nitrospiro[1,3-dioxane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 5295811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).