C14H19N11O2S — CID 5295829
2-N,2-N-dimethyl-6-[[4-methyl-5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 5295829) has the molecular formula C14H19N11O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[[4-methyl-5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[[4-methyl-5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5295829 |
| Molecular Formula | C14H19N11O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[[4-methyl-5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ncc([N+](=O)[O-])n1Cc1nnc(SCc2nc(N)nc(N(C)C)n2)n1C |
| InChI | InChI=1S/C14H19N11O2S/c1-8-16-5-11(25(26)27)24(8)6-10-20-21-14(23(10)4)28-7-9-17-12(15)19-13(18-9)22(2)3/h5H,6-7H2,1-4H3,(H2,15,17,18,19) |
| InChIKey | JLBOIAONPGCJJL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 159.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|