About 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole
1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole (PubChem CID 5296051) has the molecular formula C20H14N2O2
and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole |
| PubChem CID | 5296051 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole |
| SMILES | C(=C\c1nccc2c1[nH]c1ccccc12)\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14N2O2/c1-2-4-16-14(3-1)15-9-10-21-17(20(15)22-16)7-5-13-6-8-18-19(11-13)24-12-23-18/h1-11,22H,12H2/b7-5- |
| InChIKey | DIXVUMFALGTULE-ALCCZGGFSA-N |
| XLogP | 4.62 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole?
The IUPAC name of 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole (CID 5296051) is 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole?
The canonical SMILES for 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole is C(=C\c1nccc2c1[nH]c1ccccc12)\c1ccc2c(c1)OCO2.
What is the InChIKey of 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole?
The InChIKey is DIXVUMFALGTULE-ALCCZGGFSA-N. The full InChI is InChI=1S/C20H14N2O2/c1-2-4-16-14(3-1)15-9-10-21-17(20(15)22-16)7-5-13-6-8-18-19(11-13)24-12-23-18/h1-11,22H,12H2/b7-5-.
What are the key properties of 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole?
1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole has a molecular weight of 314.34 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-(1,3-benzodioxol-5-yl)ethenyl]-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 5296051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).