C32H30N2O5S — CID 5296065
6-(1-adamantyl)-12-(4-methylphenyl)sulfonyl-15-nitro-2-oxa-12-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaene (PubChem CID 5296065) has the molecular formula C32H30N2O5S and a molecular weight of 554.67 g/mol. Its IUPAC name is 6-(1-adamantyl)-12-(4-methylphenyl)sulfonyl-15-nitro-2-oxa-12-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaene.
| Compound Name | 6-(1-adamantyl)-12-(4-methylphenyl)sulfonyl-15-nitro-2-oxa-12-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaene |
|---|---|
| PubChem CID | 5296065 |
| Molecular Formula | C32H30N2O5S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 6-(1-adamantyl)-12-(4-methylphenyl)sulfonyl-15-nitro-2-oxa-12-azatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3(8),4,6,9,13(17),14-heptaene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=Cc4cc(C56CC7CC(CC(C7)C5)C6)ccc4Oc4cc([N+](=O)[O-])cc2c43)cc1 |
| InChI | InChI=1S/C32H30N2O5S/c1-19-2-5-27(6-3-19)40(37,38)33-18-24-11-23-12-25(32-15-20-8-21(16-32)10-22(9-20)17-32)4-7-29(23)39-30-14-26(34(35)36)13-28(33)31(24)30/h2-7,11-14,20-22H,8-10,15-18H2,1H3 |
| InChIKey | PPJNFWABBFQEIU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|