C15H16F6O2 — CID 5296151
3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentane-2,4-dione (PubChem CID 5296151) has the molecular formula C15H16F6O2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentane-2,4-dione.
| Compound Name | 3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 5296151 |
| Molecular Formula | C15H16F6O2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-(1-adamantyl)-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
| SMILES | O=C(C(C(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C15H16F6O2/c16-14(17,18)11(22)10(12(23)15(19,20)21)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-10H,1-6H2 |
| InChIKey | IJUITSDEZXHRJN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|