About 2-butan-2-yl-1,3-oxathiolane
2-butan-2-yl-1,3-oxathiolane (PubChem CID 529633) has the molecular formula C7H14OS
and a molecular weight of 146.25 g/mol. Its IUPAC name is 2-butan-2-yl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-butan-2-yl-1,3-oxathiolane |
| PubChem CID | 529633 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-butan-2-yl-1,3-oxathiolane |
| SMILES | CCC(C)C1OCCS1 |
| InChI | InChI=1S/C7H14OS/c1-3-6(2)7-8-4-5-9-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | KCMYKIVZSSTBPP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-1,3-oxathiolane?
The IUPAC name of 2-butan-2-yl-1,3-oxathiolane (CID 529633) is 2-butan-2-yl-1,3-oxathiolane.
What is the SMILES notation for 2-butan-2-yl-1,3-oxathiolane?
The canonical SMILES for 2-butan-2-yl-1,3-oxathiolane is CCC(C)C1OCCS1.
What is the InChIKey of 2-butan-2-yl-1,3-oxathiolane?
The InChIKey is KCMYKIVZSSTBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS/c1-3-6(2)7-8-4-5-9-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-butan-2-yl-1,3-oxathiolane?
2-butan-2-yl-1,3-oxathiolane has a molecular weight of 146.25 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1,3-oxathiolane is sourced from PubChem (CID 529633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).