C16H10F3N3O2S — CID 5296673
10-[4-(trifluoromethyl)phenyl]-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione (PubChem CID 5296673) has the molecular formula C16H10F3N3O2S and a molecular weight of 365.34 g/mol. Its IUPAC name is 10-[4-(trifluoromethyl)phenyl]-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione.
| Compound Name | 10-[4-(trifluoromethyl)phenyl]-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione |
|---|---|
| PubChem CID | 5296673 |
| Molecular Formula | C16H10F3N3O2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 10-[4-(trifluoromethyl)phenyl]-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione |
| SMILES | O=C1CC(c2ccc(C(F)(F)F)cc2)c2c(n3ccsc3nc2=O)N1 |
| InChI | InChI=1S/C16H10F3N3O2S/c17-16(18,19)9-3-1-8(2-4-9)10-7-11(23)20-13-12(10)14(24)21-15-22(13)5-6-25-15/h1-6,10H,7H2,(H,20,23) |
| InChIKey | CJKNYKMUFWZKMH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |