About 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one
7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 5297222) has the molecular formula C21H25NO2S2
and a molecular weight of 387.57 g/mol. Its IUPAC name is 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one.
Molecular Properties
| Compound Name | 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one |
| PubChem CID | 5297222 |
| Molecular Formula | C21H25NO2S2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | CCCCSc1cc2c(c(SCCCC)c1)C(=O)Nc1ccccc1O2 |
| InChI | InChI=1S/C21H25NO2S2/c1-3-5-11-25-15-13-18-20(19(14-15)26-12-6-4-2)21(23)22-16-9-7-8-10-17(16)24-18/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,22,23) |
| InChIKey | QSBUPKKSWSEIGQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one?
The IUPAC name of 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one (CID 5297222) is 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one.
What is the SMILES notation for 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one?
The canonical SMILES for 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one is CCCCSc1cc2c(c(SCCCC)c1)C(=O)Nc1ccccc1O2.
What is the InChIKey of 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one?
The InChIKey is QSBUPKKSWSEIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2S2/c1-3-5-11-25-15-13-18-20(19(14-15)26-12-6-4-2)21(23)22-16-9-7-8-10-17(16)24-18/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,22,23).
What are the key properties of 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one?
7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one has a molecular weight of 387.57 g/mol, XLogP of 6.83, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-bis(butylsulfanyl)-5H-benzo[b][1,4]benzoxazepin-6-one is sourced from PubChem (CID 5297222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).