C15H9Cl2N3O2S — CID 5297288
10-(3,4-dichlorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione (PubChem CID 5297288) has the molecular formula C15H9Cl2N3O2S and a molecular weight of 366.23 g/mol. Its IUPAC name is 10-(3,4-dichlorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione.
| Compound Name | 10-(3,4-dichlorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione |
|---|---|
| PubChem CID | 5297288 |
| Molecular Formula | C15H9Cl2N3O2S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 10-(3,4-dichlorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione |
| SMILES | O=C1CC(c2ccc(Cl)c(Cl)c2)c2c(n3ccsc3nc2=O)N1 |
| InChI | InChI=1S/C15H9Cl2N3O2S/c16-9-2-1-7(5-10(9)17)8-6-11(21)18-13-12(8)14(22)19-15-20(13)3-4-23-15/h1-5,8H,6H2,(H,18,21) |
| InChIKey | DMTPIQMBBYOHIP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |