About 8-nitroquinolin-5-ol
8-nitroquinolin-5-ol (PubChem CID 5297354) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 8-nitroquinolin-5-ol.
Molecular Properties
| Compound Name | 8-nitroquinolin-5-ol |
| PubChem CID | 5297354 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 8-nitroquinolin-5-ol |
| SMILES | O=[N+]([O-])c1ccc(O)c2cccnc12 |
| InChI | InChI=1S/C9H6N2O3/c12-8-4-3-7(11(13)14)9-6(8)2-1-5-10-9/h1-5,12H |
| InChIKey | GBFQOBPPJULZSN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitroquinolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitroquinolin-5-ol?
The IUPAC name of 8-nitroquinolin-5-ol (CID 5297354) is 8-nitroquinolin-5-ol.
What is the SMILES notation for 8-nitroquinolin-5-ol?
The canonical SMILES for 8-nitroquinolin-5-ol is O=[N+]([O-])c1ccc(O)c2cccnc12.
What is the InChIKey of 8-nitroquinolin-5-ol?
The InChIKey is GBFQOBPPJULZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-8-4-3-7(11(13)14)9-6(8)2-1-5-10-9/h1-5,12H.
What are the key properties of 8-nitroquinolin-5-ol?
8-nitroquinolin-5-ol has a molecular weight of 190.16 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitroquinolin-5-ol is sourced from PubChem (CID 5297354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).