About 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione
1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione (PubChem CID 5297397) has the molecular formula C19H16N2O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione.
Molecular Properties
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione |
| PubChem CID | 5297397 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione |
| SMILES | Cn1cc(C(=O)C(=O)N2CCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C19H16N2O2/c1-20-12-15(14-7-3-5-9-17(14)20)18(22)19(23)21-11-10-13-6-2-4-8-16(13)21/h2-9,12H,10-11H2,1H3 |
| InChIKey | AUEOENXYGUXLOS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione?
The IUPAC name of 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione (CID 5297397) is 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione.
What is the SMILES notation for 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione?
The canonical SMILES for 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione is Cn1cc(C(=O)C(=O)N2CCc3ccccc32)c2ccccc21.
What is the InChIKey of 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione?
The InChIKey is AUEOENXYGUXLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2/c1-20-12-15(14-7-3-5-9-17(14)20)18(22)19(23)21-11-10-13-6-2-4-8-16(13)21/h2-9,12H,10-11H2,1H3.
What are the key properties of 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione?
1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione has a molecular weight of 304.35 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroindol-1-yl)-2-(1-methylindol-3-yl)ethane-1,2-dione is sourced from PubChem (CID 5297397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).