C17H19NO2 — CID 52974084
2-(2,4-dimethylphenyl)imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione (PubChem CID 52974084) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione.
| Compound Name | 2-(2,4-dimethylphenyl)imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione |
|---|---|
| PubChem CID | 52974084 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(2,4-dimethylphenyl)imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione |
| SMILES | Cc1ccc(N=C2C(=O)C3CCCCC3C2=O)c(C)c1 |
| InChI | InChI=1S/C17H19NO2/c1-10-7-8-14(11(2)9-10)18-15-16(19)12-5-3-4-6-13(12)17(15)20/h7-9,12-13H,3-6H2,1-2H3 |
| InChIKey | NXARHKMJLXKMRQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|