C20H17F3N4O2S — CID 5297520
5-amino-N-[4-(trifluoromethoxy)phenyl]-7-thia-1,9-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,5,8-tetraene-6-carboxamide (PubChem CID 5297520) has the molecular formula C20H17F3N4O2S and a molecular weight of 434.44 g/mol. Its IUPAC name is 5-amino-N-[4-(trifluoromethoxy)phenyl]-7-thia-1,9-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,5,8-tetraene-6-carboxamide.
| Compound Name | 5-amino-N-[4-(trifluoromethoxy)phenyl]-7-thia-1,9-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,5,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 5297520 |
| Molecular Formula | C20H17F3N4O2S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 5-amino-N-[4-(trifluoromethoxy)phenyl]-7-thia-1,9-diazatetracyclo[9.2.2.02,10.04,8]pentadeca-2(10),3,5,8-tetraene-6-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(OC(F)(F)F)cc2)sc2nc3c(cc12)N1CCC3CC1 |
| InChI | InChI=1S/C20H17F3N4O2S/c21-20(22,23)29-12-3-1-11(2-4-12)25-18(28)17-15(24)13-9-14-16(26-19(13)30-17)10-5-7-27(14)8-6-10/h1-4,9-10H,5-8,24H2,(H,25,28) |
| InChIKey | HCIUROXHCABSQQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |