C16H22FN3O — CID 52975427
N-[1-(4-fluorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 52975427) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 52975427 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CC(NC(=O)C1NNC2CCCCC21)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FN3O/c1-10(11-6-8-12(17)9-7-11)18-16(21)15-13-4-2-3-5-14(13)19-20-15/h6-10,13-15,19-20H,2-5H2,1H3,(H,18,21) |
| InChIKey | XRSCFUSYGUFMCG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |