About 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine
5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine (PubChem CID 5297702) has the molecular formula C17H14ClN3
and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine.
Molecular Properties
| Compound Name | 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine |
| PubChem CID | 5297702 |
| Molecular Formula | C17H14ClN3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine |
| SMILES | Nc1c2c(nc3cccc(Cl)c13)N(c1ccccc1)CC2 |
| InChI | InChI=1S/C17H14ClN3/c18-13-7-4-8-14-15(13)16(19)12-9-10-21(17(12)20-14)11-5-2-1-3-6-11/h1-8H,9-10H2,(H2,19,20) |
| InChIKey | DCCKMZCHOVMDSU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine?
The IUPAC name of 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine (CID 5297702) is 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine.
What is the SMILES notation for 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine?
The canonical SMILES for 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine is Nc1c2c(nc3cccc(Cl)c13)N(c1ccccc1)CC2.
What is the InChIKey of 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine?
The InChIKey is DCCKMZCHOVMDSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3/c18-13-7-4-8-14-15(13)16(19)12-9-10-21(17(12)20-14)11-5-2-1-3-6-11/h1-8H,9-10H2,(H2,19,20).
What are the key properties of 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine?
5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine has a molecular weight of 295.77 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine is sourced from PubChem (CID 5297702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).