About ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate
ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate (PubChem CID 52978427) has the molecular formula C12H15F2N3O4S
and a molecular weight of 335.33 g/mol. Its IUPAC name is ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate |
| PubChem CID | 52978427 |
| Molecular Formula | C12H15F2N3O4S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1CNNC1S(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2N3O4S/c1-2-21-12(18)8-6-15-16-11(8)22(19,20)17-10-4-3-7(13)5-9(10)14/h3-5,8,11,15-17H,2,6H2,1H3 |
| InChIKey | CJWBCFKIRJYCLL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate?
The IUPAC name of ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate (CID 52978427) is ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate.
What is the SMILES notation for ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate?
The canonical SMILES for ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate is CCOC(=O)C1CNNC1S(=O)(=O)Nc1ccc(F)cc1F.
What is the InChIKey of ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate?
The InChIKey is CJWBCFKIRJYCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N3O4S/c1-2-21-12(18)8-6-15-16-11(8)22(19,20)17-10-4-3-7(13)5-9(10)14/h3-5,8,11,15-17H,2,6H2,1H3.
What are the key properties of ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate?
ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate has a molecular weight of 335.33 g/mol, XLogP of 0.32, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2,4-difluorophenyl)sulfamoyl]pyrazolidine-4-carboxylate is sourced from PubChem (CID 52978427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).