About propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate
propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 529793) has the molecular formula C8H12F3NO3
and a molecular weight of 227.18 g/mol. Its IUPAC name is propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| PubChem CID | 529793 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3/c1-4(2)15-6(13)5(3)12-7(14)8(9,10)11/h4-5H,1-3H3,(H,12,14) |
| InChIKey | ZWQQFANFZOAONR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The IUPAC name of propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate (CID 529793) is propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate.
What is the SMILES notation for propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The canonical SMILES for propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate is CC(C)OC(=O)C(C)NC(=O)C(F)(F)F.
What is the InChIKey of propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The InChIKey is ZWQQFANFZOAONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO3/c1-4(2)15-6(13)5(3)12-7(14)8(9,10)11/h4-5H,1-3H3,(H,12,14).
What are the key properties of propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate?
propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate has a molecular weight of 227.18 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]propanoate is sourced from PubChem (CID 529793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).