About 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine
2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine (PubChem CID 5298115) has the molecular formula C24H23BrN2O2
and a molecular weight of 451.36 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine.
Molecular Properties
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine |
| PubChem CID | 5298115 |
| Molecular Formula | C24H23BrN2O2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine |
| SMILES | Cc1ccc(N2CCN(c3ccc(C)cc3)C2c2cc3c(cc2Br)OCO3)cc1 |
| InChI | InChI=1S/C24H23BrN2O2/c1-16-3-7-18(8-4-16)26-11-12-27(19-9-5-17(2)6-10-19)24(26)20-13-22-23(14-21(20)25)29-15-28-22/h3-10,13-14,24H,11-12,15H2,1-2H3 |
| InChIKey | PLOWKLGDJBPXFV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine?
The IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine (CID 5298115) is 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine.
What is the SMILES notation for 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine?
The canonical SMILES for 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine is Cc1ccc(N2CCN(c3ccc(C)cc3)C2c2cc3c(cc2Br)OCO3)cc1.
What is the InChIKey of 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine?
The InChIKey is PLOWKLGDJBPXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23BrN2O2/c1-16-3-7-18(8-4-16)26-11-12-27(19-9-5-17(2)6-10-19)24(26)20-13-22-23(14-21(20)25)29-15-28-22/h3-10,13-14,24H,11-12,15H2,1-2H3.
What are the key properties of 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine?
2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine has a molecular weight of 451.36 g/mol, XLogP of 5.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1,3-benzodioxol-5-yl)-1,3-bis(4-methylphenyl)imidazolidine is sourced from PubChem (CID 5298115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).