About 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride
1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride (PubChem CID 52983519) has the molecular formula C11H12ClFN2O
and a molecular weight of 242.68 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride |
| PubChem CID | 52983519 |
| Molecular Formula | C11H12ClFN2O |
| Molecular Weight | 242.68 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride |
| SMILES | CC(N)c1ncc(-c2ccc(F)cc2)o1.Cl |
| InChI | InChI=1S/C11H11FN2O.ClH/c1-7(13)11-14-6-10(15-11)8-2-4-9(12)5-3-8;/h2-7H,13H2,1H3;1H |
| InChIKey | NGOLRVTURVPGFG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride?
The IUPAC name of 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride (CID 52983519) is 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride.
What is the SMILES notation for 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride?
The canonical SMILES for 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride is CC(N)c1ncc(-c2ccc(F)cc2)o1.Cl.
What is the InChIKey of 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride?
The InChIKey is NGOLRVTURVPGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O.ClH/c1-7(13)11-14-6-10(15-11)8-2-4-9(12)5-3-8;/h2-7H,13H2,1H3;1H.
What are the key properties of 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride?
1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride has a molecular weight of 242.68 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]ethanamine;hydrochloride is sourced from PubChem (CID 52983519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).