About 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride
2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (PubChem CID 52983691) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| PubChem CID | 52983691 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| SMILES | CC1CNc2ccccc2O1.Cl |
| InChI | InChI=1S/C9H11NO.ClH/c1-7-6-10-8-4-2-3-5-9(8)11-7;/h2-5,7,10H,6H2,1H3;1H |
| InChIKey | URMVZRDREQXIPA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CID 52983691) is 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride is CC1CNc2ccccc2O1.Cl.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The InChIKey is URMVZRDREQXIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.ClH/c1-7-6-10-8-4-2-3-5-9(8)11-7;/h2-5,7,10H,6H2,1H3;1H.
What are the key properties of 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride has a molecular weight of 185.65 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride is sourced from PubChem (CID 52983691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).