5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid

C10H6FNO3 — CID 52983870

IUPAC5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)c1ncoc1-c1ccc(F)cc1
InChIInChI=1S/C10H6FNO3/c11-7-3-1-6(2-4-7)9-8(10(13)14)12-5-15-9/h1-5H,(H,13,14)
InChIKeyVXGVPBUIHUSJID-UHFFFAOYSA-N
MW207.16 g/mol
LogP2.18
Rot. Bonds2

About 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid

5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 52983870) has the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid
PubChem CID52983870
Molecular FormulaC10H6FNO3
Molecular Weight207.16 g/mol
Exact Mass207.03
IUPAC Name5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)c1ncoc1-c1ccc(F)cc1
InChIInChI=1S/C10H6FNO3/c11-7-3-1-6(2-4-7)9-8(10(13)14)12-5-15-9/h1-5H,(H,13,14)
InChIKeyVXGVPBUIHUSJID-UHFFFAOYSA-N
XLogP2.18
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.16
LogP ≤ 52.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid (CID 52983870) is 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid is O=C(O)c1ncoc1-c1ccc(F)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid?
The InChIKey is VXGVPBUIHUSJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FNO3/c11-7-3-1-6(2-4-7)9-8(10(13)14)12-5-15-9/h1-5H,(H,13,14).
What are the key properties of 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid?
5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid has a molecular weight of 207.16 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 52983870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).