C20H31ClN2O — CID 52984382
(3-methylphenyl)-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 52984382) has the molecular formula C20H31ClN2O and a molecular weight of 350.93 g/mol. Its IUPAC name is (3-methylphenyl)-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (3-methylphenyl)-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 52984382 |
| Molecular Formula | C20H31ClN2O |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (3-methylphenyl)-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cc1cccc(C(=O)N2CCCCC2CCN2CCCCC2)c1.Cl |
| InChI | InChI=1S/C20H30N2O.ClH/c1-17-8-7-9-18(16-17)20(23)22-14-6-3-10-19(22)11-15-21-12-4-2-5-13-21;/h7-9,16,19H,2-6,10-15H2,1H3;1H |
| InChIKey | IACIZWBHMJTCGY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |