About hexadec-4-enyl acetate
hexadec-4-enyl acetate (PubChem CID 529846) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is hexadec-4-enyl acetate.
Molecular Properties
| Compound Name | hexadec-4-enyl acetate |
| PubChem CID | 529846 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | hexadec-4-enyl acetate |
| SMILES | CCCCCCCCCCCC=CCCCOC(C)=O |
| InChI | InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h13-14H,3-12,15-17H2,1-2H3 |
| InChIKey | CBFTVSZYHOCWBZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexadec-4-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-4-enyl acetate?
The IUPAC name of hexadec-4-enyl acetate (CID 529846) is hexadec-4-enyl acetate.
What is the SMILES notation for hexadec-4-enyl acetate?
The canonical SMILES for hexadec-4-enyl acetate is CCCCCCCCCCCC=CCCCOC(C)=O.
What is the InChIKey of hexadec-4-enyl acetate?
The InChIKey is CBFTVSZYHOCWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h13-14H,3-12,15-17H2,1-2H3.
What are the key properties of hexadec-4-enyl acetate?
hexadec-4-enyl acetate has a molecular weight of 282.47 g/mol, XLogP of 5.81, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-4-enyl acetate is sourced from PubChem (CID 529846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).